Name | bis(pentafluorophenyl)oxalate |
Synonyms | PFPO ChemiluminescenceReagent PENTAFLUOROPHENYL OXALATE bis(pentafluorophenyl)oxalate BIS(PENTAFLUOROPHENYL) OXALATE Oxalic acid bis(pentafluorophenyl) ester Bis(pentafluorophenyl)oxalate[chemiluminescence reagent] |
CAS | 16536-48-4 |
InChI | InChI=1/C14F10O4/c15-1-3(17)7(21)11(8(22)4(1)18)27-13(25)14(26)28-12-9(23)5(19)2(16)6(20)10(12)24 |
Molecular Formula | C14F10O4 |
Molar Mass | 422.13 |
Density | 1.798±0.06 g/cm3(Predicted) |
Boling Point | 318.9±42.0 °C(Predicted) |
Flash Point | 141.9°C |
Vapor Presure | 0.000351mmHg at 25°C |
Appearance | powder to crystal |
Color | White to Almost white |
Storage Condition | Room Temprature |
Refractive Index | 1.456 |
WGK Germany | 3 |
Uses | Bis (pentafluorophenyl) oxalate is an ester compound, which can be used as a chemiluminescent reagent. |